C14H26N2O19S4-4 — CID 91258011
[(5S,6R)-4-hydroxy-6-methoxy-5-(sulfonatoamino)oxan-2-yl]methyl sulfate;[4-hydroxy-6-methyl-5-(sulfonatoamino)oxan-2-yl]methyl sulfate (PubChem CID 91258011) has the molecular formula C14H26N2O19S4-4 and a molecular weight of 654.62 g/mol. Its IUPAC name is [(5S,6R)-4-hydroxy-6-methoxy-5-(sulfonatoamino)oxan-2-yl]methyl sulfate;[4-hydroxy-6-methyl-5-(sulfonatoamino)oxan-2-yl]methyl sulfate.
| Compound Name | [(5S,6R)-4-hydroxy-6-methoxy-5-(sulfonatoamino)oxan-2-yl]methyl sulfate;[4-hydroxy-6-methyl-5-(sulfonatoamino)oxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 91258011 |
| Molecular Formula | C14H26N2O19S4-4 |
| Molecular Weight | 654.62 g/mol |
| Exact Mass | 654.00 |
| IUPAC Name | [(5S,6R)-4-hydroxy-6-methoxy-5-(sulfonatoamino)oxan-2-yl]methyl sulfate;[4-hydroxy-6-methyl-5-(sulfonatoamino)oxan-2-yl]methyl sulfate |
| SMILES | CC1OC(COS(=O)(=O)[O-])CC(O)C1NS(=O)(=O)[O-].CO[C@@H]1OC(COS(=O)(=O)[O-])CC(O)[C@@H]1NS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H15NO10S2.C7H15NO9S2/c1-16-7-6(8-19(10,11)12)5(9)2-4(18-7)3-17-20(13,14)15;1-4-7(8-18(10,11)12)6(9)2-5(17-4)3-16-19(13,14)15/h4-9H,2-3H2,1H3,(H,10,11,12)(H,13,14,15);4-9H,2-3H2,1H3,(H,10,11,12)(H,13,14,15)/p-4/t4?,5?,6-,7+;/m0./s1 |
| InChIKey | BWIMASNHPKFAAK-RCSYXONVSA-J |
| XLogP | -5.58 |
| TPSA | 339.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.62 |
| LogP ≤ 5 | -5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|