C9H17O7S- — CID 20705033
(4-hydroxy-6-methoxy-3,5-dimethyloxan-2-yl)methyl sulfate (PubChem CID 20705033) has the molecular formula C9H17O7S- and a molecular weight of 269.30 g/mol. Its IUPAC name is (4-hydroxy-6-methoxy-3,5-dimethyloxan-2-yl)methyl sulfate.
| Compound Name | (4-hydroxy-6-methoxy-3,5-dimethyloxan-2-yl)methyl sulfate |
|---|---|
| PubChem CID | 20705033 |
| Molecular Formula | C9H17O7S- |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (4-hydroxy-6-methoxy-3,5-dimethyloxan-2-yl)methyl sulfate |
| SMILES | COC1OC(COS(=O)(=O)[O-])C(C)C(O)C1C |
| InChI | InChI=1S/C9H18O7S/c1-5-7(4-15-17(11,12)13)16-9(14-3)6(2)8(5)10/h5-10H,4H2,1-3H3,(H,11,12,13)/p-1 |
| InChIKey | KUBVNNBZOICWPM-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|