C19H36O6 — CID 24763935
(2R,3R,4R,5R,6R)-2-[3-[(2R,3R,4R,5R,6R)-4-hydroxy-6-methoxy-3,5-dimethyloxan-2-yl]propyl]-6-methoxy-3,5-dimethyloxan-4-ol (PubChem CID 24763935) has the molecular formula C19H36O6 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-[3-[(2R,3R,4R,5R,6R)-4-hydroxy-6-methoxy-3,5-dimethyloxan-2-yl]propyl]-6-methoxy-3,5-dimethyloxan-4-ol.
| Compound Name | (2R,3R,4R,5R,6R)-2-[3-[(2R,3R,4R,5R,6R)-4-hydroxy-6-methoxy-3,5-dimethyloxan-2-yl]propyl]-6-methoxy-3,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 24763935 |
| Molecular Formula | C19H36O6 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-[3-[(2R,3R,4R,5R,6R)-4-hydroxy-6-methoxy-3,5-dimethyloxan-2-yl]propyl]-6-methoxy-3,5-dimethyloxan-4-ol |
| SMILES | CO[C@@H]1O[C@H](CCC[C@H]2O[C@@H](OC)[C@H](C)[C@H](O)[C@H]2C)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C19H36O6/c1-10-14(24-18(22-5)12(3)16(10)20)8-7-9-15-11(2)17(21)13(4)19(23-6)25-15/h10-21H,7-9H2,1-6H3/t10-,11-,12+,13+,14+,15+,16+,17+,18+,19+/m0/s1 |
| InChIKey | KUYOOXNWFNBVTD-NJFLDOCBSA-N |
| XLogP | 2.17 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |