C11H24NO4+ — CID 77422832
[4-hydroxy-6-(hydroxymethyl)-2-methoxy-5-methyloxan-3-yl]-trimethylazanium (PubChem CID 77422832) has the molecular formula C11H24NO4+ and a molecular weight of 234.32 g/mol. Its IUPAC name is [4-hydroxy-6-(hydroxymethyl)-2-methoxy-5-methyloxan-3-yl]-trimethylazanium.
| Compound Name | [4-hydroxy-6-(hydroxymethyl)-2-methoxy-5-methyloxan-3-yl]-trimethylazanium |
|---|---|
| PubChem CID | 77422832 |
| Molecular Formula | C11H24NO4+ |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | [4-hydroxy-6-(hydroxymethyl)-2-methoxy-5-methyloxan-3-yl]-trimethylazanium |
| SMILES | COC1OC(CO)C(C)C(O)C1[N+](C)(C)C |
| InChI | InChI=1S/C11H24NO4/c1-7-8(6-13)16-11(15-5)9(10(7)14)12(2,3)4/h7-11,13-14H,6H2,1-5H3/q+1 |
| InChIKey | BARMYYHEHJOLRK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|