C14H32O4 — CID 168912950
ethane;6-methoxy-5-methyl-2-propyloxane-3,4-diol (PubChem CID 168912950) has the molecular formula C14H32O4 and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;6-methoxy-5-methyl-2-propyloxane-3,4-diol.
| Compound Name | ethane;6-methoxy-5-methyl-2-propyloxane-3,4-diol |
|---|---|
| PubChem CID | 168912950 |
| Molecular Formula | C14H32O4 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | ethane;6-methoxy-5-methyl-2-propyloxane-3,4-diol |
| SMILES | CC.CC.CCCC1OC(OC)C(C)C(O)C1O |
| InChI | InChI=1S/C10H20O4.2C2H6/c1-4-5-7-9(12)8(11)6(2)10(13-3)14-7;2*1-2/h6-12H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | JLFXBNJGZKPCCJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |