C14H28O2 — CID 22948046
3,4-diethyl-2-methoxy-5-methyl-6-propyloxane (PubChem CID 22948046) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 3,4-diethyl-2-methoxy-5-methyl-6-propyloxane.
| Compound Name | 3,4-diethyl-2-methoxy-5-methyl-6-propyloxane |
|---|---|
| PubChem CID | 22948046 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 3,4-diethyl-2-methoxy-5-methyl-6-propyloxane |
| SMILES | CCCC1OC(OC)C(CC)C(CC)C1C |
| InChI | InChI=1S/C14H28O2/c1-6-9-13-10(4)11(7-2)12(8-3)14(15-5)16-13/h10-14H,6-9H2,1-5H3 |
| InChIKey | ZWPWEZXLDDZWNV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |