C10H18FIO2 — CID 58349947
(2S,3R,4R,5R,6S)-5-ethyl-3-fluoro-2-(iodomethyl)-6-methoxy-4-methyloxane (PubChem CID 58349947) has the molecular formula C10H18FIO2 and a molecular weight of 316.15 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-5-ethyl-3-fluoro-2-(iodomethyl)-6-methoxy-4-methyloxane.
| Compound Name | (2S,3R,4R,5R,6S)-5-ethyl-3-fluoro-2-(iodomethyl)-6-methoxy-4-methyloxane |
|---|---|
| PubChem CID | 58349947 |
| Molecular Formula | C10H18FIO2 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (2S,3R,4R,5R,6S)-5-ethyl-3-fluoro-2-(iodomethyl)-6-methoxy-4-methyloxane |
| SMILES | CC[C@H]1[C@@H](OC)O[C@H](CI)[C@H](F)[C@@H]1C |
| InChI | InChI=1S/C10H18FIO2/c1-4-7-6(2)9(11)8(5-12)14-10(7)13-3/h6-10H,4-5H2,1-3H3/t6-,7-,8-,9-,10+/m1/s1 |
| InChIKey | HBCFHEXTPLFSAC-IGORNWKESA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|