C7H13FO3 — CID 158893262
(3S,4S,5R)-5-ethyl-4-fluoro-2-methoxyoxolan-3-ol (PubChem CID 158893262) has the molecular formula C7H13FO3 and a molecular weight of 164.18 g/mol. Its IUPAC name is (3S,4S,5R)-5-ethyl-4-fluoro-2-methoxyoxolan-3-ol.
| Compound Name | (3S,4S,5R)-5-ethyl-4-fluoro-2-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 158893262 |
| Molecular Formula | C7H13FO3 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (3S,4S,5R)-5-ethyl-4-fluoro-2-methoxyoxolan-3-ol |
| SMILES | CC[C@H]1OC(OC)[C@H](O)[C@@H]1F |
| InChI | InChI=1S/C7H13FO3/c1-3-4-5(8)6(9)7(10-2)11-4/h4-7,9H,3H2,1-2H3/t4-,5-,6-,7?/m1/s1 |
| InChIKey | JEMSNMCQHYHPPA-RKEPMNIXSA-N |
| XLogP | 0.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |