C30H60O21 — CID 158329736
cyclohexane-1,2,3,4,5,6-hexol;bis((2R,4S,5R)-2-ethyl-6-(hydroxymethyl)oxane-3,4,5-triol);(2R,4S,5R)-2-ethyl-6-methoxyoxane-3,4,5-triol (PubChem CID 158329736) has the molecular formula C30H60O21 and a molecular weight of 756.79 g/mol. Its IUPAC name is cyclohexane-1,2,3,4,5,6-hexol;bis((2R,4S,5R)-2-ethyl-6-(hydroxymethyl)oxane-3,4,5-triol);(2R,4S,5R)-2-ethyl-6-methoxyoxane-3,4,5-triol.
| Compound Name | cyclohexane-1,2,3,4,5,6-hexol;bis((2R,4S,5R)-2-ethyl-6-(hydroxymethyl)oxane-3,4,5-triol);(2R,4S,5R)-2-ethyl-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 158329736 |
| Molecular Formula | C30H60O21 |
| Molecular Weight | 756.79 g/mol |
| Exact Mass | 756.36 |
| IUPAC Name | cyclohexane-1,2,3,4,5,6-hexol;bis((2R,4S,5R)-2-ethyl-6-(hydroxymethyl)oxane-3,4,5-triol);(2R,4S,5R)-2-ethyl-6-methoxyoxane-3,4,5-triol |
| SMILES | CC[C@H]1OC(CO)[C@H](O)[C@@H](O)C1O.CC[C@H]1OC(CO)[C@H](O)[C@@H](O)C1O.CC[C@H]1OC(OC)[C@H](O)[C@@H](O)C1O.OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/3C8H16O5.C6H12O6/c1-3-4-5(9)6(10)7(11)8(12-2)13-4;2*1-2-4-6(10)8(12)7(11)5(3-9)13-4;7-1-2(8)4(10)6(12)5(11)3(1)9/h4-11H,3H2,1-2H3;2*4-12H,2-3H2,1H3;1-12H/t4-,5?,6+,7-,8?;2*4-,5?,6?,7+,8+;/m111./s1 |
| InChIKey | GPVYGBNFEKOYBW-YSWZFRDTSA-N |
| XLogP | -8.51 |
| TPSA | 380.83 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.79 |
| LogP ≤ 5 | -8.51 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 21 |