C7H16NO5P — CID 167490800
2-(5-amino-4,6-dihydroxyoxan-2-yl)ethylphosphonous acid (PubChem CID 167490800) has the molecular formula C7H16NO5P and a molecular weight of 225.18 g/mol. Its IUPAC name is 2-(5-amino-4,6-dihydroxyoxan-2-yl)ethylphosphonous acid.
| Compound Name | 2-(5-amino-4,6-dihydroxyoxan-2-yl)ethylphosphonous acid |
|---|---|
| PubChem CID | 167490800 |
| Molecular Formula | C7H16NO5P |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(5-amino-4,6-dihydroxyoxan-2-yl)ethylphosphonous acid |
| SMILES | NC1C(O)CC(CCP(O)O)OC1O |
| InChI | InChI=1S/C7H16NO5P/c8-6-5(9)3-4(13-7(6)10)1-2-14(11)12/h4-7,9-12H,1-3,8H2 |
| InChIKey | RJJFLNGHUWZUSL-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|