C11H22N2O6 — CID 143974221
(1R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxycyclohexane-1,3-diol (PubChem CID 143974221) has the molecular formula C11H22N2O6 and a molecular weight of 278.31 g/mol. Its IUPAC name is (1R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxycyclohexane-1,3-diol.
| Compound Name | (1R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxycyclohexane-1,3-diol |
|---|---|
| PubChem CID | 143974221 |
| Molecular Formula | C11H22N2O6 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxycyclohexane-1,3-diol |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](O)C(O[C@@H]2O[C@H](CO)C[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C11H22N2O6/c12-5-2-6(13)9(17)10(8(5)16)19-11-7(15)1-4(3-14)18-11/h4-11,14-17H,1-3,12-13H2/t4-,5-,6+,7+,8+,9-,10?,11-/m0/s1 |
| InChIKey | HUCYHUKREQLTSO-ODDLVPPRSA-N |
| XLogP | -3.38 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |