C12H29N3O14S2 — CID 118816015
2-(aminomethyl)-6-(4,6-diamino-2,3-dihydroxycyclohexyl)oxyoxane-3,5-diol;sulfuric acid (PubChem CID 118816015) has the molecular formula C12H29N3O14S2 and a molecular weight of 503.51 g/mol. Its IUPAC name is 2-(aminomethyl)-6-(4,6-diamino-2,3-dihydroxycyclohexyl)oxyoxane-3,5-diol;sulfuric acid.
| Compound Name | 2-(aminomethyl)-6-(4,6-diamino-2,3-dihydroxycyclohexyl)oxyoxane-3,5-diol;sulfuric acid |
|---|---|
| PubChem CID | 118816015 |
| Molecular Formula | C12H29N3O14S2 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 2-(aminomethyl)-6-(4,6-diamino-2,3-dihydroxycyclohexyl)oxyoxane-3,5-diol;sulfuric acid |
| SMILES | NCC1OC(OC2C(N)CC(N)C(O)C2O)C(O)CC1O.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C12H25N3O6.2H2O4S/c13-3-8-6(16)2-7(17)12(20-8)21-11-5(15)1-4(14)9(18)10(11)19;2*1-5(2,3)4/h4-12,16-19H,1-3,13-15H2;2*(H2,1,2,3,4) |
| InChIKey | XJMADHQCYPREQM-UHFFFAOYSA-N |
| XLogP | -5.36 |
| TPSA | 326.64 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|