C8H15F2O4P — CID 167490958
2-(2,2-difluoro-4,5-dihydroxycyclohexyl)ethylphosphonous acid (PubChem CID 167490958) has the molecular formula C8H15F2O4P and a molecular weight of 244.17 g/mol. Its IUPAC name is 2-(2,2-difluoro-4,5-dihydroxycyclohexyl)ethylphosphonous acid.
| Compound Name | 2-(2,2-difluoro-4,5-dihydroxycyclohexyl)ethylphosphonous acid |
|---|---|
| PubChem CID | 167490958 |
| Molecular Formula | C8H15F2O4P |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(2,2-difluoro-4,5-dihydroxycyclohexyl)ethylphosphonous acid |
| SMILES | OC1CC(CCP(O)O)C(F)(F)CC1O |
| InChI | InChI=1S/C8H15F2O4P/c9-8(10)4-7(12)6(11)3-5(8)1-2-15(13)14/h5-7,11-14H,1-4H2 |
| InChIKey | VQYULFISCWKYIC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|