C6H12O7S — CID 22874580
[(2S,3S,4S,5R)-4,5-dihydroxy-2-methyloxan-3-yl] hydrogen sulfate (PubChem CID 22874580) has the molecular formula C6H12O7S and a molecular weight of 228.22 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-4,5-dihydroxy-2-methyloxan-3-yl] hydrogen sulfate.
| Compound Name | [(2S,3S,4S,5R)-4,5-dihydroxy-2-methyloxan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 22874580 |
| Molecular Formula | C6H12O7S |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | [(2S,3S,4S,5R)-4,5-dihydroxy-2-methyloxan-3-yl] hydrogen sulfate |
| SMILES | C[C@@H]1OC[C@@H](O)[C@H](O)[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C6H12O7S/c1-3-6(13-14(9,10)11)5(8)4(7)2-12-3/h3-8H,2H2,1H3,(H,9,10,11)/t3-,4+,5-,6+/m0/s1 |
| InChIKey | PGPMZZARTVWIPP-BGPJRJDNSA-N |
| XLogP | -1.69 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|