C9H14O9S — CID 57234795
[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(3-oxoprop-2-enyl)oxan-2-yl]methyl hydrogen sulfate (PubChem CID 57234795) has the molecular formula C9H14O9S and a molecular weight of 298.27 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(3-oxoprop-2-enyl)oxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(3-oxoprop-2-enyl)oxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 57234795 |
| Molecular Formula | C9H14O9S |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(3-oxoprop-2-enyl)oxan-2-yl]methyl hydrogen sulfate |
| SMILES | O=C=CC[C@@H]1O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H14O9S/c10-3-1-2-5-7(11)9(13)8(12)6(18-5)4-17-19(14,15)16/h1,5-9,11-13H,2,4H2,(H,14,15,16)/t5-,6+,7+,8+,9+/m0/s1 |
| InChIKey | DZFMWWBMHBCESZ-XDQCBXAXSA-N |
| XLogP | -2.57 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|