C17H32O9S — CID 10645361
[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-undec-10-enoxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 10645361) has the molecular formula C17H32O9S and a molecular weight of 412.50 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-undec-10-enoxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-undec-10-enoxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 10645361 |
| Molecular Formula | C17H32O9S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-undec-10-enoxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | C=CCCCCCCCCCO[C@@H]1O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H32O9S/c1-2-3-4-5-6-7-8-9-10-11-24-17-16(20)15(19)14(18)13(26-17)12-25-27(21,22)23/h2,13-20H,1,3-12H2,(H,21,22,23)/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | HLQKBXBXKKCLKW-NQNKBUKLSA-N |
| XLogP | 0.94 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|