C11H20O6S — CID 87574823
5-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanethial (PubChem CID 87574823) has the molecular formula C11H20O6S and a molecular weight of 280.34 g/mol. Its IUPAC name is 5-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanethial.
| Compound Name | 5-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanethial |
|---|---|
| PubChem CID | 87574823 |
| Molecular Formula | C11H20O6S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanethial |
| SMILES | OC[C@H]1O[C@H](OCCCCC=S)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20O6S/c12-6-7-8(13)9(14)10(15)11(17-7)16-4-2-1-3-5-18/h5,7-15H,1-4,6H2/t7-,8-,9+,10+,11+/m1/s1 |
| InChIKey | UVOJXRMXUUWBSP-UVOCVTCTSA-N |
| XLogP | -1.03 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|