C8H14O6S — CID 54766518
2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethanethial (PubChem CID 54766518) has the molecular formula C8H14O6S and a molecular weight of 238.26 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethanethial.
| Compound Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethanethial |
|---|---|
| PubChem CID | 54766518 |
| Molecular Formula | C8H14O6S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethanethial |
| SMILES | OC[C@H]1O[C@@H](OCC=S)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O6S/c9-3-4-5(10)6(11)7(12)8(14-4)13-1-2-15/h2,4-12H,1,3H2/t4-,5-,6+,7-,8-/m1/s1 |
| InChIKey | BFGBBMZFOHBRIQ-JAJWTYFOSA-N |
| XLogP | -2.20 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|