C24H46O6 — CID 70957862
2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxane-3,4,5-triol (PubChem CID 70957862) has the molecular formula C24H46O6 and a molecular weight of 430.63 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70957862 |
| Molecular Formula | C24H46O6 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | 2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxane-3,4,5-triol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C24H46O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-29-24-23(28)22(27)21(26)20(19-25)30-24/h9-10,20-28H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | USRFSMGJHJJTMJ-KTKRTIGZSA-N |
| XLogP | 3.84 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|