C24H47NO8S — CID 118474548
[(2R,3S,4R,5R,6S)-5-amino-3,4-dihydroxy-6-[(Z)-octadec-9-enoxy]oxan-2-yl]methyl hydrogen sulfate (PubChem CID 118474548) has the molecular formula C24H47NO8S and a molecular weight of 509.71 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-amino-3,4-dihydroxy-6-[(Z)-octadec-9-enoxy]oxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-amino-3,4-dihydroxy-6-[(Z)-octadec-9-enoxy]oxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 118474548 |
| Molecular Formula | C24H47NO8S |
| Molecular Weight | 509.71 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-amino-3,4-dihydroxy-6-[(Z)-octadec-9-enoxy]oxan-2-yl]methyl hydrogen sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCO[C@H]1O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C24H47NO8S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-31-24-21(25)23(27)22(26)20(33-24)19-32-34(28,29)30/h9-10,20-24,26-27H,2-8,11-19,25H2,1H3,(H,28,29,30)/b10-9-/t20-,21-,22-,23-,24+/m1/s1 |
| InChIKey | VVPBKTFNQQDAPZ-SRBGBNFASA-N |
| XLogP | 3.63 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|