C17H31NO8 — CID 90248226
butyl 5-[6-(acetyloxymethyl)-3-amino-4,5-dihydroxyoxan-2-yl]oxypentanoate (PubChem CID 90248226) has the molecular formula C17H31NO8 and a molecular weight of 377.43 g/mol. Its IUPAC name is butyl 5-[6-(acetyloxymethyl)-3-amino-4,5-dihydroxyoxan-2-yl]oxypentanoate.
| Compound Name | butyl 5-[6-(acetyloxymethyl)-3-amino-4,5-dihydroxyoxan-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 90248226 |
| Molecular Formula | C17H31NO8 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | butyl 5-[6-(acetyloxymethyl)-3-amino-4,5-dihydroxyoxan-2-yl]oxypentanoate |
| SMILES | CCCCOC(=O)CCCCOC1OC(COC(C)=O)C(O)C(O)C1N |
| InChI | InChI=1S/C17H31NO8/c1-3-4-8-23-13(20)7-5-6-9-24-17-14(18)16(22)15(21)12(26-17)10-25-11(2)19/h12,14-17,21-22H,3-10,18H2,1-2H3 |
| InChIKey | MFCSHPIBARKYSX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|