C54H98CaO20S2 — CID 87348636
calcium bis([(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[3-[(Z)-octadec-9-enoyl]oxypropoxy]oxan-2-yl]methanesulfonate) (PubChem CID 87348636) has the molecular formula C54H98CaO20S2 and a molecular weight of 1171.57 g/mol. Its IUPAC name is calcium bis([(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[3-[(Z)-octadec-9-enoyl]oxypropoxy]oxan-2-yl]methanesulfonate).
| Compound Name | calcium bis([(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[3-[(Z)-octadec-9-enoyl]oxypropoxy]oxan-2-yl]methanesulfonate) |
|---|---|
| PubChem CID | 87348636 |
| Molecular Formula | C54H98CaO20S2 |
| Molecular Weight | 1171.57 g/mol |
| Exact Mass | 1170.57 |
| IUPAC Name | calcium bis([(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[3-[(Z)-octadec-9-enoyl]oxypropoxy]oxan-2-yl]methanesulfonate) |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCO[C@@H]1O[C@H](CS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O.CCCCCCCC/C=C\CCCCCCCC(=O)OCCCO[C@@H]1O[C@H](CS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O.[Ca+2] |
| InChI | InChI=1S/2C27H50O10S.Ca/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-23(28)35-19-17-20-36-27-26(31)25(30)24(29)22(37-27)21-38(32,33)34;/h2*9-10,22,24-27,29-31H,2-8,11-21H2,1H3,(H,32,33,34);/q;;+2/p-2/b2*10-9-;/t2*22-,24-,25+,26-,27-;/m11./s1 |
| InChIKey | HMAHKAABDNDKNY-JBIAGSLWSA-L |
| XLogP | 6.27 |
| TPSA | 325.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 77 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1171.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|