C41H74O12S — CID 162789563
[6-[2,3-di(hexadec-8-enoyloxy)propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 162789563) has the molecular formula C41H74O12S and a molecular weight of 791.10 g/mol. Its IUPAC name is [6-[2,3-di(hexadec-8-enoyloxy)propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | [6-[2,3-di(hexadec-8-enoyloxy)propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 162789563 |
| Molecular Formula | C41H74O12S |
| Molecular Weight | 791.10 g/mol |
| Exact Mass | 790.49 |
| IUPAC Name | [6-[2,3-di(hexadec-8-enoyloxy)propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | CCCCCCCC=CCCCCCCC(=O)OCC(COC1OC(CS(=O)(=O)O)C(O)C(O)C1O)OC(=O)CCCCCCC=CCCCCCCC |
| InChI | InChI=1S/C41H74O12S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-36(42)50-31-34(32-51-41-40(46)39(45)38(44)35(53-41)33-54(47,48)49)52-37(43)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h15-18,34-35,38-41,44-46H,3-14,19-33H2,1-2H3,(H,47,48,49) |
| InChIKey | JAJQHMCAOZKADN-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.10 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|