C46H84O12S — CID 138276102
[6-[2-[(Z)-henicos-11-enoyl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 138276102) has the molecular formula C46H84O12S and a molecular weight of 861.23 g/mol. Its IUPAC name is [6-[2-[(Z)-henicos-11-enoyl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | [6-[2-[(Z)-henicos-11-enoyl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 138276102 |
| Molecular Formula | C46H84O12S |
| Molecular Weight | 861.23 g/mol |
| Exact Mass | 860.57 |
| IUPAC Name | [6-[2-[(Z)-henicos-11-enoyl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(COC1OC(CS(=O)(=O)O)C(O)C(O)C1O)OC(=O)CCCCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C46H84O12S/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-33-35-42(48)57-39(37-56-46-45(51)44(50)43(49)40(58-46)38-59(52,53)54)36-55-41(47)34-32-30-28-26-24-22-16-14-12-10-8-6-4-2/h14,16,18-19,39-40,43-46,49-51H,3-13,15,17,20-38H2,1-2H3,(H,52,53,54)/b16-14-,19-18- |
| InChIKey | UWXGFKRMMWNLHO-JHHNDBJRSA-N |
| XLogP | 9.62 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.23 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|