C37H68O12S — CID 134755840
[(2S,3S,6S)-6-[(2S)-2-decanoyloxy-3-[(E)-octadec-7-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 134755840) has the molecular formula C37H68O12S and a molecular weight of 737.01 g/mol. Its IUPAC name is [(2S,3S,6S)-6-[(2S)-2-decanoyloxy-3-[(E)-octadec-7-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | [(2S,3S,6S)-6-[(2S)-2-decanoyloxy-3-[(E)-octadec-7-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 134755840 |
| Molecular Formula | C37H68O12S |
| Molecular Weight | 737.01 g/mol |
| Exact Mass | 736.44 |
| IUPAC Name | [(2S,3S,6S)-6-[(2S)-2-decanoyloxy-3-[(E)-octadec-7-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | CCCCCCCCCC/C=C/CCCCCC(=O)OC[C@H](CO[C@H]1O[C@H](CS(=O)(=O)O)[C@@H](O)C(O)C1O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C37H68O12S/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-21-23-25-32(38)46-27-30(48-33(39)26-24-22-19-10-8-6-4-2)28-47-37-36(42)35(41)34(40)31(49-37)29-50(43,44)45/h16-17,30-31,34-37,40-42H,3-15,18-29H2,1-2H3,(H,43,44,45)/b17-16+/t30-,31-,34-,35?,36?,37+/m1/s1 |
| InChIKey | OOEWDJABNLQVKO-QOICVTOFSA-N |
| XLogP | 6.33 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.01 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|