C38H70O12S — CID 134735215
[(2S,3S,6S)-3,4,5-trihydroxy-6-[(2S)-2-[(E)-octadec-7-enoyl]oxy-3-undecanoyloxypropoxy]oxan-2-yl]methanesulfonic acid (PubChem CID 134735215) has the molecular formula C38H70O12S and a molecular weight of 751.03 g/mol. Its IUPAC name is [(2S,3S,6S)-3,4,5-trihydroxy-6-[(2S)-2-[(E)-octadec-7-enoyl]oxy-3-undecanoyloxypropoxy]oxan-2-yl]methanesulfonic acid.
| Compound Name | [(2S,3S,6S)-3,4,5-trihydroxy-6-[(2S)-2-[(E)-octadec-7-enoyl]oxy-3-undecanoyloxypropoxy]oxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 134735215 |
| Molecular Formula | C38H70O12S |
| Molecular Weight | 751.03 g/mol |
| Exact Mass | 750.46 |
| IUPAC Name | [(2S,3S,6S)-3,4,5-trihydroxy-6-[(2S)-2-[(E)-octadec-7-enoyl]oxy-3-undecanoyloxypropoxy]oxan-2-yl]methanesulfonic acid |
| SMILES | CCCCCCCCCC/C=C/CCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCC)CO[C@H]1O[C@H](CS(=O)(=O)O)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C38H70O12S/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-23-25-27-34(40)49-31(28-47-33(39)26-24-22-20-12-10-8-6-4-2)29-48-38-37(43)36(42)35(41)32(50-38)30-51(44,45)46/h17-18,31-32,35-38,41-43H,3-16,19-30H2,1-2H3,(H,44,45,46)/b18-17+/t31-,32-,35-,36?,37?,38+/m1/s1 |
| InChIKey | HHSLPVBOERHUHK-NAAQJVRYSA-N |
| XLogP | 6.72 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.03 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|