C45H82O12S — CID 134734059
[(2S,3S,6S)-6-[(2S)-2,3-bis[[(E)-octadec-9-enoyl]oxy]propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 134734059) has the molecular formula C45H82O12S and a molecular weight of 847.21 g/mol. Its IUPAC name is [(2S,3S,6S)-6-[(2S)-2,3-bis[[(E)-octadec-9-enoyl]oxy]propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | [(2S,3S,6S)-6-[(2S)-2,3-bis[[(E)-octadec-9-enoyl]oxy]propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 134734059 |
| Molecular Formula | C45H82O12S |
| Molecular Weight | 847.21 g/mol |
| Exact Mass | 846.55 |
| IUPAC Name | [(2S,3S,6S)-6-[(2S)-2,3-bis[[(E)-octadec-9-enoyl]oxy]propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC[C@H](CO[C@H]1O[C@H](CS(=O)(=O)O)[C@@H](O)C(O)C1O)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C45H82O12S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(46)54-35-38(36-55-45-44(50)43(49)42(48)39(57-45)37-58(51,52)53)56-41(47)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,38-39,42-45,48-50H,3-16,21-37H2,1-2H3,(H,51,52,53)/b19-17+,20-18+/t38-,39-,42-,43?,44?,45+/m1/s1 |
| InChIKey | GXOWRPXZUJJAEL-JUXJBCOCSA-N |
| XLogP | 9.23 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.21 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|