C16H25N2O8P — CID 10927580
bis(2-cyanoethyl) [(2R,3S,4R,5R)-3,4-dihydroxy-5-pent-4-enoxyoxolan-2-yl]methyl phosphate (PubChem CID 10927580) has the molecular formula C16H25N2O8P and a molecular weight of 404.36 g/mol. Its IUPAC name is bis(2-cyanoethyl) [(2R,3S,4R,5R)-3,4-dihydroxy-5-pent-4-enoxyoxolan-2-yl]methyl phosphate.
| Compound Name | bis(2-cyanoethyl) [(2R,3S,4R,5R)-3,4-dihydroxy-5-pent-4-enoxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 10927580 |
| Molecular Formula | C16H25N2O8P |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | bis(2-cyanoethyl) [(2R,3S,4R,5R)-3,4-dihydroxy-5-pent-4-enoxyoxolan-2-yl]methyl phosphate |
| SMILES | C=CCCCO[C@@H]1O[C@H](COP(=O)(OCCC#N)OCCC#N)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25N2O8P/c1-2-3-4-9-22-16-15(20)14(19)13(26-16)12-25-27(21,23-10-5-7-17)24-11-6-8-18/h2,13-16,19-20H,1,3-6,9-12H2/t13-,14-,15-,16-/m1/s1 |
| InChIKey | LMSFXFKDEYTHHG-KLHDSHLOSA-N |
| XLogP | 1.40 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|