C11H19N3O5 — CID 134878515
(2R,3R,4R,5R)-5-azido-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4-diol (PubChem CID 134878515) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-azido-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-azido-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 134878515 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (2R,3R,4R,5R)-5-azido-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4-diol |
| SMILES | C=CCCCOC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H19N3O5/c1-2-3-4-5-18-11-8(13-14-12)10(17)9(16)7(6-15)19-11/h2,7-11,15-17H,1,3-6H2/t7-,8-,9+,10-,11?/m1/s1 |
| InChIKey | KOQTXQCJAQOXOX-YBTJCZCISA-N |
| XLogP | 0.09 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|