C38H39N2O14P — CID 121429508
5-[(2S,4S,5R)-3,4,5-tribenzoyloxy-6-[bis(2-cyanoethoxy)phosphoryloxymethyl]oxan-2-yl]oxypentanoic acid (PubChem CID 121429508) has the molecular formula C38H39N2O14P and a molecular weight of 778.70 g/mol. Its IUPAC name is 5-[(2S,4S,5R)-3,4,5-tribenzoyloxy-6-[bis(2-cyanoethoxy)phosphoryloxymethyl]oxan-2-yl]oxypentanoic acid.
| Compound Name | 5-[(2S,4S,5R)-3,4,5-tribenzoyloxy-6-[bis(2-cyanoethoxy)phosphoryloxymethyl]oxan-2-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 121429508 |
| Molecular Formula | C38H39N2O14P |
| Molecular Weight | 778.70 g/mol |
| Exact Mass | 778.21 |
| IUPAC Name | 5-[(2S,4S,5R)-3,4,5-tribenzoyloxy-6-[bis(2-cyanoethoxy)phosphoryloxymethyl]oxan-2-yl]oxypentanoic acid |
| SMILES | N#CCCOP(=O)(OCCC#N)OCC1O[C@H](OCCCCC(=O)O)C(OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H39N2O14P/c39-21-12-24-48-55(46,49-25-13-22-40)50-26-30-32(52-35(43)27-14-4-1-5-15-27)33(53-36(44)28-16-6-2-7-17-28)34(54-37(45)29-18-8-3-9-19-29)38(51-30)47-23-11-10-20-31(41)42/h1-9,14-19,30,32-34,38H,10-13,20,23-26H2,(H,41,42)/t30?,32-,33+,34?,38+/m1/s1 |
| InChIKey | GAWZJUXLDLPDIC-VMOLXKHJSA-N |
| XLogP | 5.64 |
| TPSA | 227.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|