C39H40NO14P — CID 11621933
[(2R,3R,4S,5S,6S)-4,5-dibenzoyloxy-2-(dimethoxyphosphoryloxymethyl)-6-[2-(phenylmethoxycarbonylamino)ethoxy]oxan-3-yl] benzoate (PubChem CID 11621933) has the molecular formula C39H40NO14P and a molecular weight of 777.72 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4,5-dibenzoyloxy-2-(dimethoxyphosphoryloxymethyl)-6-[2-(phenylmethoxycarbonylamino)ethoxy]oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-4,5-dibenzoyloxy-2-(dimethoxyphosphoryloxymethyl)-6-[2-(phenylmethoxycarbonylamino)ethoxy]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11621933 |
| Molecular Formula | C39H40NO14P |
| Molecular Weight | 777.72 g/mol |
| Exact Mass | 777.22 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5-dibenzoyloxy-2-(dimethoxyphosphoryloxymethyl)-6-[2-(phenylmethoxycarbonylamino)ethoxy]oxan-3-yl] benzoate |
| SMILES | COP(=O)(OC)OC[C@H]1O[C@H](OCCNC(=O)OCc2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C39H40NO14P/c1-46-55(45,47-2)50-26-31-32(52-35(41)28-17-9-4-10-18-28)33(53-36(42)29-19-11-5-12-20-29)34(54-37(43)30-21-13-6-14-22-30)38(51-31)48-24-23-40-39(44)49-25-27-15-7-3-8-16-27/h3-22,31-34,38H,23-26H2,1-2H3,(H,40,44)/t31-,32-,33+,34+,38+/m1/s1 |
| InChIKey | GALOYRMAZBGYFY-JPJNNHMFSA-N |
| XLogP | 5.75 |
| TPSA | 180.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|