C48H41O13P — CID 170416016
[(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-bis(phenylmethoxy)phosphoryloxyoxan-2-yl]methyl benzoate (PubChem CID 170416016) has the molecular formula C48H41O13P and a molecular weight of 856.82 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-bis(phenylmethoxy)phosphoryloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-bis(phenylmethoxy)phosphoryloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 170416016 |
| Molecular Formula | C48H41O13P |
| Molecular Weight | 856.82 g/mol |
| Exact Mass | 856.23 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-bis(phenylmethoxy)phosphoryloxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H41O13P/c49-44(36-23-11-3-12-24-36)54-33-40-41(58-45(50)37-25-13-4-14-26-37)42(59-46(51)38-27-15-5-16-28-38)43(60-47(52)39-29-17-6-18-30-39)48(57-40)61-62(53,55-31-34-19-7-1-8-20-34)56-32-35-21-9-2-10-22-35/h1-30,40-43,48H,31-33H2/t40-,41-,42+,43+,48+/m1/s1 |
| InChIKey | QPLBBUBIVKYCFN-QSLCVBDPSA-N |
| XLogP | 8.80 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.82 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|