C17H21NO5S — CID 102312265
[(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl 3-phenylpropanoate (PubChem CID 102312265) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl 3-phenylpropanoate.
| Compound Name | [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 102312265 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl 3-phenylpropanoate |
| SMILES | CC1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](COC(=O)CCc3ccccc3)O[C@@H]2S1 |
| InChI | InChI=1S/C17H21NO5S/c1-10-18-14-16(21)15(20)12(23-17(14)24-10)9-22-13(19)8-7-11-5-3-2-4-6-11/h2-6,12,14-17,20-21H,7-9H2,1H3/t12-,14-,15-,16-,17-/m1/s1 |
| InChIKey | DCCXBFABBMSGTK-LMHBHQSJSA-N |
| XLogP | 1.14 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |