C49H57NO8 — CID 174274530
[(2R,3S,4S,5R,6S)-6-[(2S,3R)-2-amino-3-phenylmethoxyhexoxy]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 3-phenylpropanoate (PubChem CID 174274530) has the molecular formula C49H57NO8 and a molecular weight of 787.99 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[(2S,3R)-2-amino-3-phenylmethoxyhexoxy]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 3-phenylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[(2S,3R)-2-amino-3-phenylmethoxyhexoxy]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 174274530 |
| Molecular Formula | C49H57NO8 |
| Molecular Weight | 787.99 g/mol |
| Exact Mass | 787.41 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2S,3R)-2-amino-3-phenylmethoxyhexoxy]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 3-phenylpropanoate |
| SMILES | CCC[C@@H](OCc1ccccc1)[C@@H](N)CO[C@H]1O[C@H](COC(=O)CCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H57NO8/c1-2-18-43(52-31-38-21-10-4-11-22-38)42(50)35-57-49-48(56-34-41-27-16-7-17-28-41)47(55-33-40-25-14-6-15-26-40)46(54-32-39-23-12-5-13-24-39)44(58-49)36-53-45(51)30-29-37-19-8-3-9-20-37/h3-17,19-28,42-44,46-49H,2,18,29-36,50H2,1H3/t42-,43+,44+,46-,47-,48+,49-/m0/s1 |
| InChIKey | PJUYJORTEPQYNM-ZAQZFMKZSA-N |
| XLogP | 8.37 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.99 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |