C46H53NO8 — CID 174135985
(2R,3S,4S)-4-amino-3-phenylmethoxy-5-[(2S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypentan-2-ol (PubChem CID 174135985) has the molecular formula C46H53NO8 and a molecular weight of 747.93 g/mol. Its IUPAC name is (2R,3S,4S)-4-amino-3-phenylmethoxy-5-[(2S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypentan-2-ol.
| Compound Name | (2R,3S,4S)-4-amino-3-phenylmethoxy-5-[(2S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypentan-2-ol |
|---|---|
| PubChem CID | 174135985 |
| Molecular Formula | C46H53NO8 |
| Molecular Weight | 747.93 g/mol |
| Exact Mass | 747.38 |
| IUPAC Name | (2R,3S,4S)-4-amino-3-phenylmethoxy-5-[(2S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypentan-2-ol |
| SMILES | C[C@@H](O)[C@@H](OCc1ccccc1)[C@@H](N)CO[C@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C46H53NO8/c1-34(48)42(50-28-36-19-9-3-10-20-36)40(47)32-54-46-45(53-31-39-25-15-6-16-26-39)44(52-30-38-23-13-5-14-24-38)43(51-29-37-21-11-4-12-22-37)41(55-46)33-49-27-35-17-7-2-8-18-35/h2-26,34,40-46,48H,27-33,47H2,1H3/t34-,40+,41?,42-,43+,44?,45?,46+/m1/s1 |
| InChIKey | LFPHDOHDXKXADY-QMXIFAOKSA-N |
| XLogP | 6.99 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.93 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |