C54H59NO10 — CID 11411919
(2R,3R,4R,6E)-6-hydroxyimino-3,4-bis(phenylmethoxy)-1-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhexan-2-ol (PubChem CID 11411919) has the molecular formula C54H59NO10 and a molecular weight of 882.06 g/mol. Its IUPAC name is (2R,3R,4R,6E)-6-hydroxyimino-3,4-bis(phenylmethoxy)-1-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhexan-2-ol.
| Compound Name | (2R,3R,4R,6E)-6-hydroxyimino-3,4-bis(phenylmethoxy)-1-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhexan-2-ol |
|---|---|
| PubChem CID | 11411919 |
| Molecular Formula | C54H59NO10 |
| Molecular Weight | 882.06 g/mol |
| Exact Mass | 881.41 |
| IUPAC Name | (2R,3R,4R,6E)-6-hydroxyimino-3,4-bis(phenylmethoxy)-1-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhexan-2-ol |
| SMILES | O/N=C/C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)CO[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C54H59NO10/c56-47(50(60-35-43-23-11-3-12-24-43)48(31-32-55-57)59-34-42-21-9-2-10-22-42)39-64-54-53(63-38-46-29-17-6-18-30-46)52(62-37-45-27-15-5-16-28-45)51(61-36-44-25-13-4-14-26-44)49(65-54)40-58-33-41-19-7-1-8-20-41/h1-30,32,47-54,56-57H,31,33-40H2/b55-32+/t47-,48-,49-,50-,51+,52+,53-,54+/m1/s1 |
| InChIKey | CLIWAOJAJVKHBC-BYORBUAHSA-N |
| XLogP | 9.08 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.06 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|