C51H58O9 — CID 14211901
(2R,3R,4R,5R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3-prop-2-enoxy-5-[(2S,3R,4R)-2,3,4-tris(phenylmethoxy)-5-prop-2-enoxypentoxy]oxolane (PubChem CID 14211901) has the molecular formula C51H58O9 and a molecular weight of 815.02 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3-prop-2-enoxy-5-[(2S,3R,4R)-2,3,4-tris(phenylmethoxy)-5-prop-2-enoxypentoxy]oxolane.
| Compound Name | (2R,3R,4R,5R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3-prop-2-enoxy-5-[(2S,3R,4R)-2,3,4-tris(phenylmethoxy)-5-prop-2-enoxypentoxy]oxolane |
|---|---|
| PubChem CID | 14211901 |
| Molecular Formula | C51H58O9 |
| Molecular Weight | 815.02 g/mol |
| Exact Mass | 814.41 |
| IUPAC Name | (2R,3R,4R,5R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3-prop-2-enoxy-5-[(2S,3R,4R)-2,3,4-tris(phenylmethoxy)-5-prop-2-enoxypentoxy]oxolane |
| SMILES | C=CCOC[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](CO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCC=C)[C@H]1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C51H58O9/c1-3-30-52-37-45(55-33-41-22-12-6-13-23-41)48(57-35-43-26-16-8-17-27-43)46(56-34-42-24-14-7-15-25-42)39-59-51-50(58-36-44-28-18-9-19-29-44)49(54-31-4-2)47(60-51)38-53-32-40-20-10-5-11-21-40/h3-29,45-51H,1-2,30-39H2/t45-,46+,47-,48-,49-,50-,51-/m1/s1 |
| InChIKey | BENIGVLXDRAWIK-XHKIDFCKSA-N |
| XLogP | 9.06 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.02 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|