C54H55N3O8 — CID 23628566
(4R,5S,6S)-6-azido-1-phenyl-5-phenylmethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-2-yn-4-ol (PubChem CID 23628566) has the molecular formula C54H55N3O8 and a molecular weight of 874.05 g/mol. Its IUPAC name is (4R,5S,6S)-6-azido-1-phenyl-5-phenylmethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-2-yn-4-ol.
| Compound Name | (4R,5S,6S)-6-azido-1-phenyl-5-phenylmethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-2-yn-4-ol |
|---|---|
| PubChem CID | 23628566 |
| Molecular Formula | C54H55N3O8 |
| Molecular Weight | 874.05 g/mol |
| Exact Mass | 873.40 |
| IUPAC Name | (4R,5S,6S)-6-azido-1-phenyl-5-phenylmethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-2-yn-4-ol |
| SMILES | [N-]=[N+]=N[C@@H](CO[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)C#CCc1ccccc1 |
| InChI | InChI=1S/C54H55N3O8/c55-57-56-47(50(60-35-43-24-11-3-12-25-43)48(58)33-19-32-41-20-7-1-8-21-41)39-64-54-53(63-38-46-30-17-6-18-31-46)52(62-37-45-28-15-5-16-29-45)51(61-36-44-26-13-4-14-27-44)49(65-54)40-59-34-42-22-9-2-10-23-42/h1-18,20-31,47-54,58H,32,34-40H2/t47-,48+,49+,50-,51-,52-,53+,54-/m0/s1 |
| InChIKey | YYJRCAHUNHNHQC-VMNARMGZSA-N |
| XLogP | 9.57 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.05 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|