C53H68O11 — CID 70905905
[(3R,4S,6R)-3-methyl-6-[(2R,5S)-3-methyl-6-(pentanoyloxymethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl hexanoate (PubChem CID 70905905) has the molecular formula C53H68O11 and a molecular weight of 881.12 g/mol. Its IUPAC name is [(3R,4S,6R)-3-methyl-6-[(2R,5S)-3-methyl-6-(pentanoyloxymethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl hexanoate.
| Compound Name | [(3R,4S,6R)-3-methyl-6-[(2R,5S)-3-methyl-6-(pentanoyloxymethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 70905905 |
| Molecular Formula | C53H68O11 |
| Molecular Weight | 881.12 g/mol |
| Exact Mass | 880.48 |
| IUPAC Name | [(3R,4S,6R)-3-methyl-6-[(2R,5S)-3-methyl-6-(pentanoyloxymethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OCC1O[C@H](O[C@H]2OC(COC(=O)CCCC)[C@@H](OCc3ccccc3)C(OCc3ccccc3)C2C)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C53H68O11/c1-5-7-13-31-47(55)56-36-44-38(3)48(58-32-40-22-14-9-15-23-40)51(61-35-43-28-20-12-21-29-43)53(62-44)64-52-39(4)49(59-33-41-24-16-10-17-25-41)50(60-34-42-26-18-11-19-27-42)45(63-52)37-57-46(54)30-8-6-2/h9-12,14-29,38-39,44-45,48-53H,5-8,13,30-37H2,1-4H3/t38-,39?,44?,45?,48+,49?,50-,51?,52-,53-/m1/s1 |
| InChIKey | VOCVXHLDSHNBME-NUHPPZRPSA-N |
| XLogP | 9.92 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.12 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|