C30H39NO7 — CID 11237803
[(2R,3S,4R,5R)-5-acetamido-6-oxo-3,4-bis(phenylmethoxy)oxan-2-yl]methyl octanoate (PubChem CID 11237803) has the molecular formula C30H39NO7 and a molecular weight of 525.64 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-acetamido-6-oxo-3,4-bis(phenylmethoxy)oxan-2-yl]methyl octanoate.
| Compound Name | [(2R,3S,4R,5R)-5-acetamido-6-oxo-3,4-bis(phenylmethoxy)oxan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 11237803 |
| Molecular Formula | C30H39NO7 |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | [(2R,3S,4R,5R)-5-acetamido-6-oxo-3,4-bis(phenylmethoxy)oxan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H]1OC(=O)[C@H](NC(C)=O)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H39NO7/c1-3-4-5-6-13-18-26(33)35-21-25-28(36-19-23-14-9-7-10-15-23)29(27(30(34)38-25)31-22(2)32)37-20-24-16-11-8-12-17-24/h7-12,14-17,25,27-29H,3-6,13,18-21H2,1-2H3,(H,31,32)/t25-,27-,28-,29-/m1/s1 |
| InChIKey | KORDXCKUVBVSRL-YXINZVNLSA-N |
| XLogP | 4.49 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|