C27H50O8 — CID 18650864
[(2R,3S,4S,5R)-5-decanoyloxy-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl decanoate (PubChem CID 18650864) has the molecular formula C27H50O8 and a molecular weight of 502.69 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-decanoyloxy-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl decanoate.
| Compound Name | [(2R,3S,4S,5R)-5-decanoyloxy-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl decanoate |
|---|---|
| PubChem CID | 18650864 |
| Molecular Formula | C27H50O8 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | [(2R,3S,4S,5R)-5-decanoyloxy-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H]1OC(OC)[C@H](OC(=O)CCCCCCCCC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H50O8/c1-4-6-8-10-12-14-16-18-22(28)33-20-21-24(30)25(31)26(27(32-3)34-21)35-23(29)19-17-15-13-11-9-7-5-2/h21,24-27,30-31H,4-20H2,1-3H3/t21-,24-,25+,26-,27?/m1/s1 |
| InChIKey | ZVWFWMZDFFXITC-WMWUUTHASA-N |
| XLogP | 4.82 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|