C29H63N9O7 — CID 11411180
[(2R,3S,4R,5R,6S)-5-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl N-[3-[4-(3-aminopropylamino)butylamino]propyl]carbamate (PubChem CID 11411180) has the molecular formula C29H63N9O7 and a molecular weight of 649.88 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl N-[3-[4-(3-aminopropylamino)butylamino]propyl]carbamate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl N-[3-[4-(3-aminopropylamino)butylamino]propyl]carbamate |
|---|---|
| PubChem CID | 11411180 |
| Molecular Formula | C29H63N9O7 |
| Molecular Weight | 649.88 g/mol |
| Exact Mass | 649.49 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl N-[3-[4-(3-aminopropylamino)butylamino]propyl]carbamate |
| SMILES | CO[C@H]1O[C@H](COC(=O)NCCCNCCCCNCCCN)[C@@H](O)[C@H](O)[C@H]1NC(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C29H63N9O7/c1-43-27-24(38-28(41)36-20-8-18-34-14-4-2-12-32-16-6-10-30)26(40)25(39)23(45-27)22-44-29(42)37-21-9-19-35-15-5-3-13-33-17-7-11-31/h23-27,32-35,39-40H,2-22,30-31H2,1H3,(H,37,42)(H2,36,38,41)/t23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | ASHYPGDMCXGUQF-ACFIUOAZSA-N |
| XLogP | -2.13 |
| TPSA | 238.54 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.88 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|