C14H30N2O5 — CID 11601952
(2R,3S,4R,5S,6S)-4-(7-aminoheptylamino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol (PubChem CID 11601952) has the molecular formula C14H30N2O5 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-4-(7-aminoheptylamino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol.
| Compound Name | (2R,3S,4R,5S,6S)-4-(7-aminoheptylamino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 11601952 |
| Molecular Formula | C14H30N2O5 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (2R,3S,4R,5S,6S)-4-(7-aminoheptylamino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@@H](NCCCCCCCN)[C@@H]1O |
| InChI | InChI=1S/C14H30N2O5/c1-20-14-13(19)11(12(18)10(9-17)21-14)16-8-6-4-2-3-5-7-15/h10-14,16-19H,2-9,15H2,1H3/t10-,11-,12-,13+,14+/m1/s1 |
| InChIKey | DRIWSUKTAPIPPG-POQQGIQPSA-N |
| XLogP | -1.06 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|