C11H23NO5 — CID 70497751
(2R,3S,4R,5R,6S)-4-(butylamino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol (PubChem CID 70497751) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-4-(butylamino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol.
| Compound Name | (2R,3S,4R,5R,6S)-4-(butylamino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 70497751 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (2R,3S,4R,5R,6S)-4-(butylamino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol |
| SMILES | CCCCN[C@H]1[C@@H](O)[C@@H](OC)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C11H23NO5/c1-3-4-5-12-8-9(14)7(6-13)17-11(16-2)10(8)15/h7-15H,3-6H2,1-2H3/t7-,8-,9-,10-,11+/m1/s1 |
| InChIKey | XHUSMXVSUFEJCX-ILAIQSSSSA-N |
| XLogP | -1.17 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|