C15H28N2O6 — CID 71120964
(3S,6R)-N-butyl-3,4,5-trihydroxy-6-[(2-methylpropanoylamino)methyl]oxane-2-carboxamide (PubChem CID 71120964) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3S,6R)-N-butyl-3,4,5-trihydroxy-6-[(2-methylpropanoylamino)methyl]oxane-2-carboxamide.
| Compound Name | (3S,6R)-N-butyl-3,4,5-trihydroxy-6-[(2-methylpropanoylamino)methyl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 71120964 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (3S,6R)-N-butyl-3,4,5-trihydroxy-6-[(2-methylpropanoylamino)methyl]oxane-2-carboxamide |
| SMILES | CCCCNC(=O)C1O[C@H](CNC(=O)C(C)C)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C15H28N2O6/c1-4-5-6-16-15(22)13-12(20)11(19)10(18)9(23-13)7-17-14(21)8(2)3/h8-13,18-20H,4-7H2,1-3H3,(H,16,22)(H,17,21)/t9-,10?,11?,12+,13?/m1/s1 |
| InChIKey | VZULUZPWCGLECI-FDODLTCHSA-N |
| XLogP | -1.48 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|