C10H16F3NO6 — CID 101008720
(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-(3,3,3-trifluoropropyl)oxane-2-carboxamide (PubChem CID 101008720) has the molecular formula C10H16F3NO6 and a molecular weight of 303.23 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-(3,3,3-trifluoropropyl)oxane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-(3,3,3-trifluoropropyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 101008720 |
| Molecular Formula | C10H16F3NO6 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-(3,3,3-trifluoropropyl)oxane-2-carboxamide |
| SMILES | O=C(NCCC(F)(F)F)[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16F3NO6/c11-10(12,13)1-2-14-9(19)8-7(18)6(17)5(16)4(3-15)20-8/h4-8,15-18H,1-3H2,(H,14,19)/t4-,5-,6+,7-,8-/m0/s1 |
| InChIKey | IMOHCRRLWROXME-RLMOJYMMSA-N |
| XLogP | -2.10 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |