C13H15ClFNO6 — CID 46942456
(2R,3R,4S,5R,6R)-N-(3-chloro-4-fluorophenyl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide (PubChem CID 46942456) has the molecular formula C13H15ClFNO6 and a molecular weight of 335.72 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-(3-chloro-4-fluorophenyl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-(3-chloro-4-fluorophenyl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 46942456 |
| Molecular Formula | C13H15ClFNO6 |
| Molecular Weight | 335.72 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-(3-chloro-4-fluorophenyl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H15ClFNO6/c14-6-3-5(1-2-7(6)15)16-13(21)12-11(20)10(19)9(18)8(4-17)22-12/h1-3,8-12,17-20H,4H2,(H,16,21)/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | YGWZUFXHQCFSBN-YBXAARCKSA-N |
| XLogP | -0.74 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.72 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |