C10H19NO5 — CID 44538844
(2S,3S,4S,5R)-N-butyl-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxamide (PubChem CID 44538844) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is (2S,3S,4S,5R)-N-butyl-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3S,4S,5R)-N-butyl-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 44538844 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (2S,3S,4S,5R)-N-butyl-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H19NO5/c1-2-3-4-11-10(15)9-8(14)7(13)6(5-12)16-9/h6-9,12-14H,2-5H2,1H3,(H,11,15)/t6-,7-,8+,9+/m1/s1 |
| InChIKey | IIBBZMPWPDMQBA-HXFLIBJXSA-N |
| XLogP | -1.62 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|