C14H28NO4P — CID 59036371
N-[(2R,3R,4S,5S,6S)-6-[[deuterio(tritio)methoxy]methyl]-2-(dimethylphosphanyloxymethyl)-4,5-dimethyloxan-3-yl]acetamide (PubChem CID 59036371) has the molecular formula C14H28NO4P and a molecular weight of 308.37 g/mol. Its IUPAC name is N-[(2R,3R,4S,5S,6S)-6-[[deuterio(tritio)methoxy]methyl]-2-(dimethylphosphanyloxymethyl)-4,5-dimethyloxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,5S,6S)-6-[[deuterio(tritio)methoxy]methyl]-2-(dimethylphosphanyloxymethyl)-4,5-dimethyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 59036371 |
| Molecular Formula | C14H28NO4P |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-[(2R,3R,4S,5S,6S)-6-[[deuterio(tritio)methoxy]methyl]-2-(dimethylphosphanyloxymethyl)-4,5-dimethyloxan-3-yl]acetamide |
| SMILES | [2H]C([3H])OC[C@H]1O[C@@H](COP(C)C)[C@H](NC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C14H28NO4P/c1-9-10(2)14(15-11(3)16)13(8-18-20(5)6)19-12(9)7-17-4/h9-10,12-14H,7-8H2,1-6H3,(H,15,16)/t9-,10-,12+,13-,14+/m0/s1/i4TD/t4?,9-,10-,12+,13-,14+ |
| InChIKey | NDZWOODOKSKSAR-RZSJRTRLSA-N |
| XLogP | 1.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|