C20H39N2NiO5P — CID 59949810
N-[(4S,5S,6S)-2-(2-cyanoethoxyphosphanyloxymethyl)-6-(hydroxymethyl)-4,5-dimethyloxan-3-yl]acetamide;nickel(2+);propane (PubChem CID 59949810) has the molecular formula C20H39N2NiO5P and a molecular weight of 477.21 g/mol. Its IUPAC name is N-[(4S,5S,6S)-2-(2-cyanoethoxyphosphanyloxymethyl)-6-(hydroxymethyl)-4,5-dimethyloxan-3-yl]acetamide;nickel(2+);propane.
| Compound Name | N-[(4S,5S,6S)-2-(2-cyanoethoxyphosphanyloxymethyl)-6-(hydroxymethyl)-4,5-dimethyloxan-3-yl]acetamide;nickel(2+);propane |
|---|---|
| PubChem CID | 59949810 |
| Molecular Formula | C20H39N2NiO5P |
| Molecular Weight | 477.21 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-[(4S,5S,6S)-2-(2-cyanoethoxyphosphanyloxymethyl)-6-(hydroxymethyl)-4,5-dimethyloxan-3-yl]acetamide;nickel(2+);propane |
| SMILES | CC(=O)NC1C(COPOCCC#N)O[C@H](CO)[C@@H](C)[C@@H]1C.[CH2-]CC.[CH2-]CC.[Ni+2] |
| InChI | InChI=1S/C14H25N2O5P.2C3H7.Ni/c1-9-10(2)14(16-11(3)18)13(21-12(9)7-17)8-20-22-19-6-4-5-15;2*1-3-2;/h9-10,12-14,17,22H,4,6-8H2,1-3H3,(H,16,18);2*1,3H2,2H3;/q;2*-1;+2/t9-,10-,12+,13?,14?;;;/m0.../s1 |
| InChIKey | CUWOMJVBFRDHLS-CRWGWTGLSA-N |
| XLogP | 3.44 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|